Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Copper(II) oxide, 97%
CAS: 1317-38-0 Molecular Formula: CuO Molecular Weight (g/mol): 79.55 MDL Number: MFCD00010979 InChI Key: KKCXRELNMOYFLS-UHFFFAOYSA-N Synonym: cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide PubChem CID: 14829 IUPAC Name: copper(2+) oxidandiide SMILES: [O--].[Cu++]
| PubChem CID | 14829 |
|---|---|
| CAS | 1317-38-0 |
| Molecular Weight (g/mol) | 79.55 |
| MDL Number | MFCD00010979 |
| SMILES | [O--].[Cu++] |
| Synonym | cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide |
| IUPAC Name | copper(2+) oxidandiide |
| InChI Key | KKCXRELNMOYFLS-UHFFFAOYSA-N |
| Molecular Formula | CuO |
Potassium bromate, ACS, 99.8% min
CAS: 1-2-7758 Molecular Formula: BrKO3 Molecular Weight (g/mol): 167.00 MDL Number: MFCD00011359 InChI Key: OCATYIAKPYKMPG-UHFFFAOYSA-M Synonym: potassium bromate,bromic acid, potassium salt,bromate, potassium,potassium bromate dot,unii-04mb35w6za,ccris 529,eec no. e924,bromic acid, potassium salt 1:1,potassiumbromate,kaliumbromat PubChem CID: 23673461 ChEBI: CHEBI:38211 IUPAC Name: potassium;bromate SMILES: [O-]Br(=O)=O.[K+]
| PubChem CID | 23673461 |
|---|---|
| CAS | 1-2-7758 |
| Molecular Weight (g/mol) | 167.00 |
| ChEBI | CHEBI:38211 |
| MDL Number | MFCD00011359 |
| SMILES | [O-]Br(=O)=O.[K+] |
| Synonym | potassium bromate,bromic acid, potassium salt,bromate, potassium,potassium bromate dot,unii-04mb35w6za,ccris 529,eec no. e924,bromic acid, potassium salt 1:1,potassiumbromate,kaliumbromat |
| IUPAC Name | potassium;bromate |
| InChI Key | OCATYIAKPYKMPG-UHFFFAOYSA-M |
| Molecular Formula | BrKO3 |
Titanium powder, -325 mesh, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Europium(III) oxide, 99.99%, (trace metal basis)
CAS: 1308-96-9 Molecular Formula: Eu2O3 Molecular Weight (g/mol): 351.93 MDL Number: MFCD00010997 InChI Key: AEBZCFFCDTZXHP-UHFFFAOYSA-N Synonym: europium oxide,europia,europium trioxide,dieuropium trioxide,europium sesquioxide,europium 3+ oxide,europium oxide euo1.5,europium 3+ ; oxygen 2- PubChem CID: 159371 SMILES: [O--].[O--].[O--].[Eu+3].[Eu+3]
| PubChem CID | 159371 |
|---|---|
| CAS | 1308-96-9 |
| Molecular Weight (g/mol) | 351.93 |
| MDL Number | MFCD00010997 |
| SMILES | [O--].[O--].[O--].[Eu+3].[Eu+3] |
| Synonym | europium oxide,europia,europium trioxide,dieuropium trioxide,europium sesquioxide,europium 3+ oxide,europium oxide euo1.5,europium 3+ ; oxygen 2- |
| InChI Key | AEBZCFFCDTZXHP-UHFFFAOYSA-N |
| Molecular Formula | Eu2O3 |
Barium nitrate, pure
CAS: 10022-31-8 Molecular Formula: BaN2O6 Molecular Weight (g/mol): 261.34 MDL Number: MFCD00003442 InChI Key: IWOUKMZUPDVPGQ-UHFFFAOYSA-N Synonym: barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 PubChem CID: 24798 SMILES: [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24798 |
|---|---|
| CAS | 10022-31-8 |
| Molecular Weight (g/mol) | 261.34 |
| MDL Number | MFCD00003442 |
| SMILES | [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 |
| InChI Key | IWOUKMZUPDVPGQ-UHFFFAOYSA-N |
| Molecular Formula | BaN2O6 |
Phosphoric acid, 85% w/w aq. soln., ACS
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: MFCD00011340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | MFCD00011340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
| CAS | 1317-39-1 |
|---|---|
| MDL Number | MFCD00010974 |
| Molecular Formula | Cu2O |
Silver Nitrate, in Isopropanol, Certified, 0.0100N ±0.0002N (0.01M), LabChem™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Potassium hydrogen phosphate, ACS, 98.0% min
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.17 MDL Number: MFCD00011383 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.17 |
| ChEBI | CHEBI:32031 |
| MDL Number | MFCD00011383 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |
Potassium bromide, for analysis EMSURE™; ACS,Reag. Ph Eur, MilliporeSigma™
CAS: 2-3-7758 Molecular Formula: BrK Molecular Weight (g/mol): 119.00 MDL Number: MFCD00011358 InChI Key: IOLCXVTUBQKXJR-UHFFFAOYSA-M Synonym: potassium bromide,bromide salt of potassium,kalii bromidum,bromure de potassium,caswell no. 684,tripotassium tribromide,potassium bromide k3br3,unii-osd78555zm,ccris 6095 PubChem CID: 253877 ChEBI: CHEBI:32030 IUPAC Name: potassium bromide SMILES: [K+].[Br-]
| PubChem CID | 253877 |
|---|---|
| CAS | 2-3-7758 |
| Molecular Weight (g/mol) | 119.00 |
| ChEBI | CHEBI:32030 |
| MDL Number | MFCD00011358 |
| SMILES | [K+].[Br-] |
| Synonym | potassium bromide,bromide salt of potassium,kalii bromidum,bromure de potassium,caswell no. 684,tripotassium tribromide,potassium bromide k3br3,unii-osd78555zm,ccris 6095 |
| IUPAC Name | potassium bromide |
| InChI Key | IOLCXVTUBQKXJR-UHFFFAOYSA-M |
| Molecular Formula | BrK |
Ammonium hydrogen carbonate, 99.0%
CAS: 1066-33-7 Molecular Formula: CH5NO3 Molecular Weight (g/mol): 79.06 MDL Number: MFCD00012138 InChI Key: ATRRKUHOCOJYRX-UHFFFAOYSA-N Synonym: ammonium bicarbonate,ammonium hydrogencarbonate,ammonium hydrogen carbonate,carbonic acid, monoammonium salt,monoammonium carbonate,ammonium acid carbonate,ammonium hydrogencarbonat,ammoniumbicarbonate,acid ammonium carbonate,ccris 7327 PubChem CID: 14013 IUPAC Name: carbonic acid amine SMILES: N.OC(O)=O
| PubChem CID | 14013 |
|---|---|
| CAS | 1066-33-7 |
| Molecular Weight (g/mol) | 79.06 |
| MDL Number | MFCD00012138 |
| SMILES | N.OC(O)=O |
| Synonym | ammonium bicarbonate,ammonium hydrogencarbonate,ammonium hydrogen carbonate,carbonic acid, monoammonium salt,monoammonium carbonate,ammonium acid carbonate,ammonium hydrogencarbonat,ammoniumbicarbonate,acid ammonium carbonate,ccris 7327 |
| IUPAC Name | carbonic acid amine |
| InChI Key | ATRRKUHOCOJYRX-UHFFFAOYSA-N |
| Molecular Formula | CH5NO3 |
Manganese(IV) oxide, 99.9% (metals basis)
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Ammonium sulfate, 99.9995%, (trace metal basis)
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 IUPAC Name: diazanium;sulfate SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| IUPAC Name | diazanium;sulfate |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Potassium tert-butoxide, pure, 1.6-1.7M (20 wt.%) solution in THF, AcroSeal™
CAS: 865-47-4 | C4H9KO | 112.21 g/mol
| Linear Formula | (CH3)3COK |
|---|---|
| Molecular Weight (g/mol) | 112.21 |
| InChI Key | LPNYRYFBWFDTMA-UHFFFAOYSA-N |
| Density | 0.9290g/mL |
| PubChem CID | 23665647 |
| Name Note | Pure, 1.7M (20 wt.%) solution in THF |
| Formula Weight | 112.21 |
| Color | Amber to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Potassium tert-butoxide |
| Grade | Pure |
| SMILES | CC(C)(C)[O-].[K+] |
| Concentration or Composition (by Analyte or Components) | 1.60 to 1.75M |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| MDL Number | MFCD00012162 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. Highly flammable liquid and vapour. Suspected of causing cancer. Reacts violently with water. May form explosive peroxides.<br |
| Packaging | AcroSeal™ Glass Bottle |
| Solubility Information | Solubility in water: reacts with water |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | potassium tert-butoxide,potassium tert-butanolate,potassium t-butoxide,potassium 2-methylpropan-2-olate,potassium tert-butylate,kotbu,2-methyl-2-propanol, potassium salt,tert-butoxypotassium,potassium-t-butoxide,t-buok |
| IUPAC Name | potassium;2-methylpropan-2-olate |
| Molecular Formula | C4H9KO |
| EINECS Number | 212-740-3 |
| Specific Gravity | 0.929 |
Aluminum oxide, for chromatography, basic, Brockmann I, 50-200 μm, 90A
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N IUPAC Name: dialuminium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| CAS | 1344-28-1 |
|---|---|
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| IUPAC Name | dialuminium(3+) trioxidandiide |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |